C10H11ClN4O — CID 141132128
3-chloro-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidine (PubChem CID 141132128) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is 3-chloro-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidine.
| Compound Name | 3-chloro-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 141132128 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-chloro-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidine |
| SMILES | Clc1nn(C2CCCCO2)c2ncncc12 |
| InChI | InChI=1S/C10H11ClN4O/c11-9-7-5-12-6-13-10(7)15(14-9)8-3-1-2-4-16-8/h5-6,8H,1-4H2 |
| InChIKey | IEMUKUSIPQNAMQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |