C12H15N5O — CID 3246173
4-(aziridin-1-yl)-1-[(2S)-oxan-2-yl]pyrazolo[5,4-d]pyrimidine (PubChem CID 3246173) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-(aziridin-1-yl)-1-[(2S)-oxan-2-yl]pyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-(aziridin-1-yl)-1-[(2S)-oxan-2-yl]pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 3246173 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-(aziridin-1-yl)-1-[(2S)-oxan-2-yl]pyrazolo[5,4-d]pyrimidine |
| SMILES | c1nc(N2CC2)c2cnn([C@@H]3CCCCO3)c2n1 |
| InChI | InChI=1S/C12H15N5O/c1-2-6-18-10(3-1)17-12-9(7-15-17)11(13-8-14-12)16-4-5-16/h7-8,10H,1-6H2/t10-/m0/s1 |
| InChIKey | WOWVNYFKIVFUJC-JTQLQIEISA-N |
| XLogP | 1.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|