C12H11NOS — CID 122241630
5-(1,3-benzothiazol-2-yl)pent-4-yn-1-ol (PubChem CID 122241630) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)pent-4-yn-1-ol.
| Compound Name | 5-(1,3-benzothiazol-2-yl)pent-4-yn-1-ol |
|---|---|
| PubChem CID | 122241630 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)pent-4-yn-1-ol |
| SMILES | OCCCC#Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H11NOS/c14-9-5-1-2-8-12-13-10-6-3-4-7-11(10)15-12/h3-4,6-7,14H,1,5,9H2 |
| InChIKey | HBZNOZDPQWYLKS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|