C12H12N2S — CID 170464451
4-(1,3-benzothiazol-2-yl)-N-methylbut-3-yn-1-amine (PubChem CID 170464451) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-methylbut-3-yn-1-amine.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 170464451 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-methylbut-3-yn-1-amine |
| SMILES | CNCCC#Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12N2S/c1-13-9-5-4-8-12-14-10-6-2-3-7-11(10)15-12/h2-3,6-7,13H,5,9H2,1H3 |
| InChIKey | ZQZLNQUZMLLVNM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|