C20H18N2O3S — CID 170463304
benzyl N-[4-(6-methoxy-1,3-benzothiazol-2-yl)but-3-ynyl]carbamate (PubChem CID 170463304) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is benzyl N-[4-(6-methoxy-1,3-benzothiazol-2-yl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(6-methoxy-1,3-benzothiazol-2-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463304 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | benzyl N-[4-(6-methoxy-1,3-benzothiazol-2-yl)but-3-ynyl]carbamate |
| SMILES | COc1ccc2nc(C#CCCNC(=O)OCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C20H18N2O3S/c1-24-16-10-11-17-18(13-16)26-19(22-17)9-5-6-12-21-20(23)25-14-15-7-3-2-4-8-15/h2-4,7-8,10-11,13H,6,12,14H2,1H3,(H,21,23) |
| InChIKey | BJUNLEVNOQOBMU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|