C17H14N2S — CID 66598206
2-[4-(6-methyl-2-pyridinyl)but-3-ynyl]-1,3-benzothiazole (PubChem CID 66598206) has the molecular formula C17H14N2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[4-(6-methyl-2-pyridinyl)but-3-ynyl]-1,3-benzothiazole.
| Compound Name | 2-[4-(6-methyl-2-pyridinyl)but-3-ynyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66598206 |
| Molecular Formula | C17H14N2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[4-(6-methyl-2-pyridinyl)but-3-ynyl]-1,3-benzothiazole |
| SMILES | Cc1cccc(C#CCCc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C17H14N2S/c1-13-7-6-9-14(18-13)8-2-5-12-17-19-15-10-3-4-11-16(15)20-17/h3-4,6-7,9-11H,5,12H2,1H3 |
| InChIKey | GDVIFXIYMMDDGO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|