C18H16N2S — CID 91070021
6,7-dimethyl-2-(4-pyridin-2-ylbut-3-ynyl)-1,3-benzothiazole (PubChem CID 91070021) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is 6,7-dimethyl-2-(4-pyridin-2-ylbut-3-ynyl)-1,3-benzothiazole.
| Compound Name | 6,7-dimethyl-2-(4-pyridin-2-ylbut-3-ynyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 91070021 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6,7-dimethyl-2-(4-pyridin-2-ylbut-3-ynyl)-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(CCC#Cc3ccccn3)sc2c1C |
| InChI | InChI=1S/C18H16N2S/c1-13-10-11-16-18(14(13)2)21-17(20-16)9-4-3-7-15-8-5-6-12-19-15/h5-6,8,10-12H,4,9H2,1-2H3 |
| InChIKey | PULXLINNESODAU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|