C20H19N3 — CID 141317660
2-[4-[3-(2,5-dimethylphenyl)-1H-pyrazol-5-yl]but-1-ynyl]pyridine (PubChem CID 141317660) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[4-[3-(2,5-dimethylphenyl)-1H-pyrazol-5-yl]but-1-ynyl]pyridine.
| Compound Name | 2-[4-[3-(2,5-dimethylphenyl)-1H-pyrazol-5-yl]but-1-ynyl]pyridine |
|---|---|
| PubChem CID | 141317660 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[4-[3-(2,5-dimethylphenyl)-1H-pyrazol-5-yl]but-1-ynyl]pyridine |
| SMILES | Cc1ccc(C)c(-c2cc(CCC#Cc3ccccn3)[nH]n2)c1 |
| InChI | InChI=1S/C20H19N3/c1-15-10-11-16(2)19(13-15)20-14-18(22-23-20)9-4-3-7-17-8-5-6-12-21-17/h5-6,8,10-14H,4,9H2,1-2H3,(H,22,23) |
| InChIKey | PEPWSBSJOWQEPO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|