C13H15N3OS — CID 174781369
3-(1,3-benzothiazol-2-yl)propanenitrile;N,N-dimethylformamide (PubChem CID 174781369) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)propanenitrile;N,N-dimethylformamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)propanenitrile;N,N-dimethylformamide |
|---|---|
| PubChem CID | 174781369 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)propanenitrile;N,N-dimethylformamide |
| SMILES | CN(C)C=O.N#CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H8N2S.C3H7NO/c11-7-3-6-10-12-8-4-1-2-5-9(8)13-10;1-4(2)3-5/h1-2,4-5H,3,6H2;3H,1-2H3 |
| InChIKey | UQBNNHCOENHLGM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|