C10H7NS2 — CID 169486691
3-(1,3-benzothiazol-2-yl)prop-2-yne-1-thiol (PubChem CID 169486691) has the molecular formula C10H7NS2 and a molecular weight of 205.31 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)prop-2-yne-1-thiol.
| Compound Name | 3-(1,3-benzothiazol-2-yl)prop-2-yne-1-thiol |
|---|---|
| PubChem CID | 169486691 |
| Molecular Formula | C10H7NS2 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)prop-2-yne-1-thiol |
| SMILES | SCC#Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H7NS2/c12-7-3-6-10-11-8-4-1-2-5-9(8)13-10/h1-2,4-5,12H,7H2 |
| InChIKey | WLJSRQMQCCQTAF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|