C15H10N2O2S2 — CID 61075092
N-(1,3-benzothiazol-2-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide (PubChem CID 61075092) has the molecular formula C15H10N2O2S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61075092 |
| Molecular Formula | C15H10N2O2S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc(C#CCO)s1 |
| InChI | InChI=1S/C15H10N2O2S2/c18-9-3-4-10-7-8-13(20-10)14(19)17-15-16-11-5-1-2-6-12(11)21-15/h1-2,5-8,18H,9H2,(H,16,17,19) |
| InChIKey | WRPFBZYLVRDLOS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|