C10H7N3O2S2 — CID 61075106
5-(3-hydroxyprop-1-ynyl)-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide (PubChem CID 61075106) has the molecular formula C10H7N3O2S2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61075106 |
| Molecular Formula | C10H7N3O2S2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nncs1)c1ccc(C#CCO)s1 |
| InChI | InChI=1S/C10H7N3O2S2/c14-5-1-2-7-3-4-8(17-7)9(15)12-10-13-11-6-16-10/h3-4,6,14H,5H2,(H,12,13,15) |
| InChIKey | QVPHYQBTZGWWGP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|