C11H9N3O2S — CID 61075453
5-(3-hydroxyprop-1-ynyl)-N-(1H-pyrazol-4-yl)thiophene-2-carboxamide (PubChem CID 61075453) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-(1H-pyrazol-4-yl)thiophene-2-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-(1H-pyrazol-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61075453 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-(1H-pyrazol-4-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cn[nH]c1)c1ccc(C#CCO)s1 |
| InChI | InChI=1S/C11H9N3O2S/c15-5-1-2-9-3-4-10(17-9)11(16)14-8-6-12-13-7-8/h3-4,6-7,15H,5H2,(H,12,13)(H,14,16) |
| InChIKey | SRMXXHNLIRPDQG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|