C22H24ClNO6 — CID 50993629
(2R,3R,4S,5R)-2-[4-chloro-3-[(2,4-dimethoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol (PubChem CID 50993629) has the molecular formula C22H24ClNO6 and a molecular weight of 433.89 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-chloro-3-[(2,4-dimethoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[4-chloro-3-[(2,4-dimethoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 50993629 |
| Molecular Formula | C22H24ClNO6 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-chloro-3-[(2,4-dimethoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cn([C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c3cccc(Cl)c23)c(OC)c1 |
| InChI | InChI=1S/C22H24ClNO6/c1-28-14-7-6-12(18(9-14)29-2)8-13-10-24(16-5-3-4-15(23)19(13)16)22-21(27)20(26)17(25)11-30-22/h3-7,9-10,17,20-22,25-27H,8,11H2,1-2H3/t17-,20+,21-,22-/m1/s1 |
| InChIKey | IBURDAYICISLFF-XYEHWOGUSA-N |
| XLogP | 2.51 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |