C29H28ClNO9 — CID 66608784
[2-[4-chloro-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone (PubChem CID 66608784) has the molecular formula C29H28ClNO9 and a molecular weight of 569.99 g/mol. Its IUPAC name is [2-[4-chloro-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone.
| Compound Name | [2-[4-chloro-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 66608784 |
| Molecular Formula | C29H28ClNO9 |
| Molecular Weight | 569.99 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | [2-[4-chloro-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccccc2-n2cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c3c(Cl)cccc32)c(OC)c1 |
| InChI | InChI=1S/C29H28ClNO9/c1-37-15-10-11-17(21(12-15)38-2)25(33)16-6-3-4-8-19(16)31-13-22(24-18(30)7-5-9-20(24)31)39-29-28(36)27(35)26(34)23(14-32)40-29/h3-13,23,26-29,32,34-36H,14H2,1-2H3/t23-,26+,27+,28-,29-/m1/s1 |
| InChIKey | NAUXRZMQALVGKN-ZZSLVBTLSA-N |
| XLogP | 2.71 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.99 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |