C23H20NO7P — CID 66606986
[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] dihydrogen phosphate (PubChem CID 66606986) has the molecular formula C23H20NO7P and a molecular weight of 453.39 g/mol. Its IUPAC name is [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] dihydrogen phosphate.
| Compound Name | [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 66606986 |
| Molecular Formula | C23H20NO7P |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] dihydrogen phosphate |
| SMILES | COc1ccc(C(=O)c2ccccc2-n2cc(OP(=O)(O)O)c3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C23H20NO7P/c1-29-15-11-12-18(21(13-15)30-2)23(25)17-8-4-6-10-20(17)24-14-22(31-32(26,27)28)16-7-3-5-9-19(16)24/h3-14H,1-2H3,(H2,26,27,28) |
| InChIKey | HNPMXJUPZOQKIM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|