C29H27BrClNO9 — CID 174647294
[2-[5-bromo-4-chloro-3-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone (PubChem CID 174647294) has the molecular formula C29H27BrClNO9 and a molecular weight of 648.89 g/mol. Its IUPAC name is [2-[5-bromo-4-chloro-3-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone.
| Compound Name | [2-[5-bromo-4-chloro-3-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 174647294 |
| Molecular Formula | C29H27BrClNO9 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 647.06 |
| IUPAC Name | [2-[5-bromo-4-chloro-3-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(2,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccccc2-n2cc(O[C@H]3O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]3O)c3c(Cl)c(Br)ccc32)c(OC)c1 |
| InChI | InChI=1S/C29H27BrClNO9/c1-38-14-7-8-16(20(11-14)39-2)25(34)15-5-3-4-6-18(15)32-12-21(23-19(32)10-9-17(30)24(23)31)40-29-28(37)27(36)26(35)22(13-33)41-29/h3-12,22,26-29,33,35-37H,13H2,1-2H3/t22-,26+,27+,28-,29-/m0/s1 |
| InChIKey | XDSOKJXJIDLQLM-MEGPWYFRSA-N |
| XLogP | 3.47 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |