C28H27NO8 — CID 68628987
[4-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-phenylmethanone (PubChem CID 68628987) has the molecular formula C28H27NO8 and a molecular weight of 505.52 g/mol. Its IUPAC name is [4-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-phenylmethanone.
| Compound Name | [4-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 68628987 |
| Molecular Formula | C28H27NO8 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [4-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-phenylmethanone |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(-n2cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c3ccccc32)c1 |
| InChI | InChI=1S/C28H27NO8/c1-35-17-11-12-19(24(31)16-7-3-2-4-8-16)21(13-17)29-14-22(18-9-5-6-10-20(18)29)36-28-27(34)26(33)25(32)23(15-30)37-28/h2-14,23,25-28,30,32-34H,15H2,1H3/t23-,25+,26+,27-,28-/m1/s1 |
| InChIKey | HXTLAKVSUSEYNH-FWZZJMFBSA-N |
| XLogP | 2.05 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |