C19H20O9 — CID 67128679
[3,4-dihydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-phenylmethanone (PubChem CID 67128679) has the molecular formula C19H20O9 and a molecular weight of 392.36 g/mol. Its IUPAC name is [3,4-dihydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-phenylmethanone.
| Compound Name | [3,4-dihydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 67128679 |
| Molecular Formula | C19H20O9 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [3,4-dihydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(O)c(O)c1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H20O9/c20-8-12-15(24)16(25)17(26)19(27-12)28-18-10(6-7-11(21)14(18)23)13(22)9-4-2-1-3-5-9/h1-7,12,15-17,19-21,23-26H,8H2/t12-,15-,16+,17-,19-/m1/s1 |
| InChIKey | JEDJWTCUOSVYDY-PITHAFQJSA-N |
| XLogP | -0.49 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|