C21H24O9 — CID 139640223
[2-hydroxy-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]phenyl]-phenylmethanone (PubChem CID 139640223) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is [2-hydroxy-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]phenyl]-phenylmethanone.
| Compound Name | [2-hydroxy-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 139640223 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [2-hydroxy-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(OCCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C21H24O9/c22-11-16-18(25)19(26)20(27)21(30-16)29-9-8-28-13-6-7-14(15(23)10-13)17(24)12-4-2-1-3-5-12/h1-7,10,16,18-23,25-27H,8-9,11H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | DKJGRAHCHJRJLS-QNDFHXLGSA-N |
| XLogP | -0.18 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|