C15H20O9 — CID 150429859
2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 3-hydroxybenzoate (PubChem CID 150429859) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 3-hydroxybenzoate.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 3-hydroxybenzoate |
|---|---|
| PubChem CID | 150429859 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 3-hydroxybenzoate |
| SMILES | O=C(OCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cccc(O)c1 |
| InChI | InChI=1S/C15H20O9/c16-7-10-11(18)12(19)13(20)15(24-10)23-5-4-22-14(21)8-2-1-3-9(17)6-8/h1-3,6,10-13,15-20H,4-5,7H2/t10-,11-,12+,13-,15-/m1/s1 |
| InChIKey | HJOCMGWZEQTZTQ-ZHZXCYKASA-N |
| XLogP | -1.63 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|