C18H22O6 — CID 100994417
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-naphthalen-1-ylethoxy)oxane-3,4,5-triol (PubChem CID 100994417) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-naphthalen-1-ylethoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-naphthalen-1-ylethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 100994417 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-naphthalen-1-ylethoxy)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](OCCc2cccc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H22O6/c19-10-14-15(20)16(21)17(22)18(24-14)23-9-8-12-6-3-5-11-4-1-2-7-13(11)12/h1-7,14-22H,8-10H2/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | CFFQRHTWQPXZID-UYTYNIKBSA-N |
| XLogP | 0.20 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |