C18H23NO5 — CID 155998769
(2R,3S,4R,5S,6S)-2-(hydroxymethyl)-6-[(naphthalen-1-ylmethylamino)methyl]oxane-3,4,5-triol (PubChem CID 155998769) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-2-(hydroxymethyl)-6-[(naphthalen-1-ylmethylamino)methyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6S)-2-(hydroxymethyl)-6-[(naphthalen-1-ylmethylamino)methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 155998769 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-(hydroxymethyl)-6-[(naphthalen-1-ylmethylamino)methyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](CNCc2cccc3ccccc23)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H23NO5/c20-10-15-17(22)18(23)16(21)14(24-15)9-19-8-12-6-3-5-11-4-1-2-7-13(11)12/h1-7,14-23H,8-10H2/t14-,15+,16+,17+,18+/m0/s1 |
| InChIKey | FZPKAGGABGIYBT-YYWYGQEZSA-N |
| XLogP | -0.23 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |