C28H31NO7 — CID 101118584
4-pyren-1-yl-N-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]butanamide (PubChem CID 101118584) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is 4-pyren-1-yl-N-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]butanamide.
| Compound Name | 4-pyren-1-yl-N-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]butanamide |
|---|---|
| PubChem CID | 101118584 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 4-pyren-1-yl-N-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]butanamide |
| SMILES | O=C(CCCc1ccc2ccc3cccc4ccc1c2c34)NCCO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H31NO7/c30-15-21-25(32)26(33)27(34)28(36-21)35-14-13-29-22(31)6-2-3-16-7-8-19-10-9-17-4-1-5-18-11-12-20(16)24(19)23(17)18/h1,4-5,7-12,21,25-28,30,32-34H,2-3,6,13-15H2,(H,29,31)/t21-,25+,26+,27-,28+/m1/s1 |
| InChIKey | RACDMRQJHITTOD-YHFOJYPYSA-N |
| XLogP | 1.84 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|