C20H31NO10 — CID 101118600
N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 101118600) has the molecular formula C20H31NO10 and a molecular weight of 445.47 g/mol. Its IUPAC name is N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 101118600 |
| Molecular Formula | C20H31NO10 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)NCCO[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C20H31NO10/c1-27-12-8-11(9-13(28-2)19(12)29-3)4-5-15(23)21-6-7-30-20-18(26)17(25)16(24)14(10-22)31-20/h8-9,14,16-18,20,22,24-26H,4-7,10H2,1-3H3,(H,21,23)/t14-,16+,17+,18-,20-/m1/s1 |
| InChIKey | AUJMPQAMTXKDKO-GIYWUFHFSA-N |
| XLogP | -1.42 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|