C20H31NO9 — CID 127021007
N-[2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 127021007) has the molecular formula C20H31NO9 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 127021007 |
| Molecular Formula | C20H31NO9 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-[2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)NCC[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C20H31NO9/c1-27-13-8-11(9-14(28-2)20(13)29-3)4-5-16(23)21-7-6-12-17(24)19(26)18(25)15(10-22)30-12/h8-9,12,15,17-19,22,24-26H,4-7,10H2,1-3H3,(H,21,23)/t12-,15-,17+,18+,19-/m1/s1 |
| InChIKey | HNTCFGSAUBSBSE-LCSDLDFTSA-N |
| XLogP | -1.01 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |