C21H28N2O6S — CID 55726601
N-[2-(benzylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 55726601) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55726601 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)NCCS(=O)(=O)NCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H28N2O6S/c1-27-18-13-17(14-19(28-2)21(18)29-3)9-10-20(24)22-11-12-30(25,26)23-15-16-7-5-4-6-8-16/h4-8,13-14,23H,9-12,15H2,1-3H3,(H,22,24) |
| InChIKey | RORJGLCQHNDKTD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |