C25H36N2O4 — CID 43067524
N-[2-(diethylamino)-3-phenylpropyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 43067524) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is N-[2-(diethylamino)-3-phenylpropyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[2-(diethylamino)-3-phenylpropyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 43067524 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | N-[2-(diethylamino)-3-phenylpropyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | CCN(CC)C(CNC(=O)CCc1cc(OC)c(OC)c(OC)c1)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N2O4/c1-6-27(7-2)21(15-19-11-9-8-10-12-19)18-26-24(28)14-13-20-16-22(29-3)25(31-5)23(17-20)30-4/h8-12,16-17,21H,6-7,13-15,18H2,1-5H3,(H,26,28) |
| InChIKey | QWVXTLNKSPWYOV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |