C19H22ClNO4 — CID 2679607
N-[(2-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 2679607) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 2679607 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)NCc2ccccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C19H22ClNO4/c1-23-16-10-13(11-17(24-2)19(16)25-3)8-9-18(22)21-12-14-6-4-5-7-15(14)20/h4-7,10-11H,8-9,12H2,1-3H3,(H,21,22) |
| InChIKey | UXJLGMCWSZKQCB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |