C18H27NO9 — CID 101118553
N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 101118553) has the molecular formula C18H27NO9 and a molecular weight of 401.41 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 101118553 |
| Molecular Formula | C18H27NO9 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)N[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C18H27NO9/c1-25-10-6-9(7-11(26-2)17(10)27-3)4-5-13(21)19-18-16(24)15(23)14(22)12(8-20)28-18/h6-7,12,14-16,18,20,22-24H,4-5,8H2,1-3H3,(H,19,21)/t12-,14+,15+,16-,18-/m1/s1 |
| InChIKey | UFTWKEWFKNQITH-QGHZAEEISA-N |
| XLogP | -1.44 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |