C22H23NO7 — CID 66607407
1-[2-[3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone (PubChem CID 66607407) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[2-[3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone.
| Compound Name | 1-[2-[3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 66607407 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-[2-[3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-n1cc(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c2ccccc21 |
| InChI | InChI=1S/C22H23NO7/c1-12(25)13-6-2-4-8-15(13)23-10-17(14-7-3-5-9-16(14)23)29-22-21(28)20(27)19(26)18(11-24)30-22/h2-10,18-22,24,26-28H,11H2,1H3/t18-,19+,20+,21-,22+/m1/s1 |
| InChIKey | AZOJJTVWZRALPP-CTWRKMMKSA-N |
| XLogP | 1.01 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |