C25H22ClNO8 — CID 66608048
[2-[6-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(furan-2-yl)methanone (PubChem CID 66608048) has the molecular formula C25H22ClNO8 and a molecular weight of 499.90 g/mol. Its IUPAC name is [2-[6-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(furan-2-yl)methanone.
| Compound Name | [2-[6-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 66608048 |
| Molecular Formula | C25H22ClNO8 |
| Molecular Weight | 499.90 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [2-[6-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)c1ccccc1-n1cc(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H22ClNO8/c26-13-7-8-14-17(10-13)27(16-5-2-1-4-15(16)21(29)18-6-3-9-33-18)11-19(14)34-25-24(32)23(31)22(30)20(12-28)35-25/h1-11,20,22-25,28,30-32H,12H2/t20-,22+,23+,24-,25+/m1/s1 |
| InChIKey | JNYXETMALWMVMI-MASZLTEFSA-N |
| XLogP | 2.29 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.90 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |