C22H21BrClNO7 — CID 66608150
1-[2-[5-bromo-4-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone (PubChem CID 66608150) has the molecular formula C22H21BrClNO7 and a molecular weight of 526.77 g/mol. Its IUPAC name is 1-[2-[5-bromo-4-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone.
| Compound Name | 1-[2-[5-bromo-4-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 66608150 |
| Molecular Formula | C22H21BrClNO7 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | 1-[2-[5-bromo-4-chloro-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyindol-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-n1cc(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c2c(Cl)c(Br)ccc21 |
| InChI | InChI=1S/C22H21BrClNO7/c1-10(27)11-4-2-3-5-13(11)25-8-15(17-14(25)7-6-12(23)18(17)24)31-22-21(30)20(29)19(28)16(9-26)32-22/h2-8,16,19-22,26,28-30H,9H2,1H3/t16-,19+,20+,21-,22+/m1/s1 |
| InChIKey | DCFGRJXCLJNURK-UGTAXJHQSA-N |
| XLogP | 2.43 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |