C15H17BrClNO6 — CID 68642223
(2R,3R,4S,5S,6R)-2-(5-bromo-4-chloro-1-methylindol-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 68642223) has the molecular formula C15H17BrClNO6 and a molecular weight of 422.66 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-(5-bromo-4-chloro-1-methylindol-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-(5-bromo-4-chloro-1-methylindol-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 68642223 |
| Molecular Formula | C15H17BrClNO6 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-(5-bromo-4-chloro-1-methylindol-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cn1cc(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2c(Cl)c(Br)ccc21 |
| InChI | InChI=1S/C15H17BrClNO6/c1-18-4-8(10-7(18)3-2-6(16)11(10)17)23-15-14(22)13(21)12(20)9(5-19)24-15/h2-4,9,12-15,19-22H,5H2,1H3/t9-,12-,13+,14-,15+/m1/s1 |
| InChIKey | QBIIOWIESYZUNK-CEVLRCNZSA-N |
| XLogP | 0.77 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |