C28H28N2O6 — CID 172641213
[4-(dimethylamino)phenyl]-[2-[3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyindol-1-yl]phenyl]methanone (PubChem CID 172641213) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]-[2-[3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyindol-1-yl]phenyl]methanone.
| Compound Name | [4-(dimethylamino)phenyl]-[2-[3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyindol-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 172641213 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [4-(dimethylamino)phenyl]-[2-[3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyindol-1-yl]phenyl]methanone |
| SMILES | CN(C)c1ccc(C(=O)c2ccccc2-n2cc(O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H28N2O6/c1-29(2)18-13-11-17(12-14-18)25(32)20-8-4-6-10-22(20)30-15-24(19-7-3-5-9-21(19)30)36-28-27(34)26(33)23(31)16-35-28/h3-15,23,26-28,31,33-34H,16H2,1-2H3/t23-,26+,27-,28+/m1/s1 |
| InChIKey | HNEGYGLWILCZDI-COMWGTSQSA-N |
| XLogP | 2.75 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |