2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid

C25H21NO5 — CID 118158326

IUPAC2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid
SMILESCOc1ccc(C(=O)c2ccccc2-n2cc(CC(=O)O)c3ccccc32)c(OC)c1
InChIInChI=1S/C25H21NO5/c1-30-17-11-12-20(23(14-17)31-2)25(29)19-8-4-6-10-22(19)26-15-16(13-24(27)28)18-7-3-5-9-21(18)26/h3-12,14-15H,13H2,1-2H3,(H,27,28)
InChIKeyQLTPWWANNSCKKO-UHFFFAOYSA-N
MW415.45 g/mol
LogP4.51
Rot. Bonds7

About 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid

2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid (PubChem CID 118158326) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid
PubChem CID118158326
Molecular FormulaC25H21NO5
Molecular Weight415.45 g/mol
Exact Mass415.14
IUPAC Name2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid
SMILESCOc1ccc(C(=O)c2ccccc2-n2cc(CC(=O)O)c3ccccc32)c(OC)c1
InChIInChI=1S/C25H21NO5/c1-30-17-11-12-20(23(14-17)31-2)25(29)19-8-4-6-10-22(19)26-15-16(13-24(27)28)18-7-3-5-9-21(18)26/h3-12,14-15H,13H2,1-2H3,(H,27,28)
InChIKeyQLTPWWANNSCKKO-UHFFFAOYSA-N
XLogP4.51
TPSA77.76 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms31
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500415.45
LogP ≤ 54.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid?
The IUPAC name of 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid (CID 118158326) is 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid.
What is the SMILES notation for 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid?
The canonical SMILES for 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid is COc1ccc(C(=O)c2ccccc2-n2cc(CC(=O)O)c3ccccc32)c(OC)c1.
What is the InChIKey of 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid?
The InChIKey is QLTPWWANNSCKKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO5/c1-30-17-11-12-20(23(14-17)31-2)25(29)19-8-4-6-10-22(19)26-15-16(13-24(27)28)18-7-3-5-9-21(18)26/h3-12,14-15H,13H2,1-2H3,(H,27,28).
What are the key properties of 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid?
2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid has a molecular weight of 415.45 g/mol, XLogP of 4.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]acetic acid is sourced from PubChem (CID 118158326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).