C27H25NO5 — CID 172641185
[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] butanoate (PubChem CID 172641185) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] butanoate.
| Compound Name | [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] butanoate |
|---|---|
| PubChem CID | 172641185 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] butanoate |
| SMILES | CCCC(=O)Oc1cn(-c2ccccc2C(=O)c2ccc(OC)cc2OC)c2ccccc12 |
| InChI | InChI=1S/C27H25NO5/c1-4-9-26(29)33-25-17-28(22-12-7-5-10-19(22)25)23-13-8-6-11-20(23)27(30)21-15-14-18(31-2)16-24(21)32-3/h5-8,10-17H,4,9H2,1-3H3 |
| InChIKey | OTNSJAMGHWALRS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |