C24H23NO5 — CID 170563793
(9-methylcarbazol-1-yl)-(2,3,4,5-tetramethoxyphenyl)methanone (PubChem CID 170563793) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is (9-methylcarbazol-1-yl)-(2,3,4,5-tetramethoxyphenyl)methanone.
| Compound Name | (9-methylcarbazol-1-yl)-(2,3,4,5-tetramethoxyphenyl)methanone |
|---|---|
| PubChem CID | 170563793 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (9-methylcarbazol-1-yl)-(2,3,4,5-tetramethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cccc3c4ccccc4n(C)c23)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C24H23NO5/c1-25-18-12-7-6-9-14(18)15-10-8-11-16(20(15)25)21(26)17-13-19(27-2)23(29-4)24(30-5)22(17)28-3/h6-13H,1-5H3 |
| InChIKey | LLOWXKLGBCUGHU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |