C23H22FNO6 — CID 67194463
(2R,3R,4S,5S,6R)-2-[3-(1-benzofuran-5-ylmethyl)-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 67194463) has the molecular formula C23H22FNO6 and a molecular weight of 427.43 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-(1-benzofuran-5-ylmethyl)-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-(1-benzofuran-5-ylmethyl)-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67194463 |
| Molecular Formula | C23H22FNO6 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-(1-benzofuran-5-ylmethyl)-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(Cc3ccc4occc4c3)c3c(F)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H22FNO6/c24-15-2-1-3-16-19(15)14(9-12-4-5-17-13(8-12)6-7-30-17)10-25(16)23-22(29)21(28)20(27)18(11-26)31-23/h1-8,10,18,20-23,26-29H,9,11H2/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | OMVMIBNWQLVMDI-DODNOZFWSA-N |
| XLogP | 2.09 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |