C26H25F2NO5 — CID 59740390
(2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-fluoronaphthalen-2-yl)methyl]-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740390) has the molecular formula C26H25F2NO5 and a molecular weight of 469.48 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-fluoronaphthalen-2-yl)methyl]-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-fluoronaphthalen-2-yl)methyl]-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740390 |
| Molecular Formula | C26H25F2NO5 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-fluoronaphthalen-2-yl)methyl]-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(F)c2c(Cc3ccc4cc(F)ccc4c3)cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2c1 |
| InChI | InChI=1S/C26H25F2NO5/c1-13-6-19(28)22-17(9-14-2-3-16-10-18(27)5-4-15(16)8-14)11-29(20(22)7-13)26-25(33)24(32)23(31)21(12-30)34-26/h2-8,10-11,21,23-26,30-33H,9,12H2,1H3/t21-,23-,24+,25-,26-/m1/s1 |
| InChIKey | FIFSEXXAZIWHBC-XDXGNBCUSA-N |
| XLogP | 2.94 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |