C25H25NO6S — CID 59739901
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(6-hydroxynaphthalen-2-yl)sulfanyl-5-methylindol-1-yl]oxane-3,4,5-triol (PubChem CID 59739901) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(6-hydroxynaphthalen-2-yl)sulfanyl-5-methylindol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(6-hydroxynaphthalen-2-yl)sulfanyl-5-methylindol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739901 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(6-hydroxynaphthalen-2-yl)sulfanyl-5-methylindol-1-yl]oxane-3,4,5-triol |
| SMILES | Cc1ccc2c(c1)c(Sc1ccc3cc(O)ccc3c1)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H25NO6S/c1-13-2-7-19-18(8-13)21(33-17-6-4-14-9-16(28)5-3-15(14)10-17)11-26(19)25-24(31)23(30)22(29)20(12-27)32-25/h2-11,20,22-25,27-31H,12H2,1H3/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | OCXMFRLISOJRNT-PRDVQWLOSA-N |
| XLogP | 2.93 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |