C22H25NO6S — CID 59739989
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-hydroxyphenyl)sulfanyl-4,6-dimethylindol-1-yl]oxane-3,4,5-triol (PubChem CID 59739989) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-hydroxyphenyl)sulfanyl-4,6-dimethylindol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-hydroxyphenyl)sulfanyl-4,6-dimethylindol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739989 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-hydroxyphenyl)sulfanyl-4,6-dimethylindol-1-yl]oxane-3,4,5-triol |
| SMILES | Cc1cc(C)c2c(Sc3ccc(O)cc3)cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2c1 |
| InChI | InChI=1S/C22H25NO6S/c1-11-7-12(2)18-15(8-11)23(9-17(18)30-14-5-3-13(25)4-6-14)22-21(28)20(27)19(26)16(10-24)29-22/h3-9,16,19-22,24-28H,10H2,1-2H3/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | BYWDHVQTTQEQHL-RECXWPGBSA-N |
| XLogP | 2.09 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |