C25H28ClNO7S — CID 59739873
(2R,3R,4S,5S,6R)-2-[6-chloro-3-[4-(oxan-4-yloxy)phenyl]sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59739873) has the molecular formula C25H28ClNO7S and a molecular weight of 522.02 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[6-chloro-3-[4-(oxan-4-yloxy)phenyl]sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[6-chloro-3-[4-(oxan-4-yloxy)phenyl]sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739873 |
| Molecular Formula | C25H28ClNO7S |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[6-chloro-3-[4-(oxan-4-yloxy)phenyl]sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(Sc3ccc(OC4CCOCC4)cc3)c3ccc(Cl)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H28ClNO7S/c26-14-1-6-18-19(11-14)27(25-24(31)23(30)22(29)20(13-28)34-25)12-21(18)35-17-4-2-15(3-5-17)33-16-7-9-32-10-8-16/h1-6,11-12,16,20,22-25,28-31H,7-10,13H2/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | OHGXWIVQTOUTRQ-PRDVQWLOSA-N |
| XLogP | 2.98 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |