C24H30N2O6S — CID 59740168
(2R,3R,4S,5S,6R)-2-[3-[4-(3-aminopropoxy)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740168) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-[4-(3-aminopropoxy)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-[4-(3-aminopropoxy)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740168 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-[4-(3-aminopropoxy)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cccc2c(Sc3ccc(OCCCN)cc3)cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C24H30N2O6S/c1-14-4-2-5-17-19(33-16-8-6-15(7-9-16)31-11-3-10-25)12-26(20(14)17)24-23(30)22(29)21(28)18(13-27)32-24/h2,4-9,12,18,21-24,27-30H,3,10-11,13,25H2,1H3/t18-,21-,22+,23-,24-/m1/s1 |
| InChIKey | AAKFPCDYWCBBPN-REXJZNOJSA-N |
| XLogP | 1.80 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|