C22H24FNO6 — CID 59739962
(2R,3R,4S,5S,6R)-2-[3-[(2-fluoro-4-methoxyphenyl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59739962) has the molecular formula C22H24FNO6 and a molecular weight of 417.43 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-[(2-fluoro-4-methoxyphenyl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-[(2-fluoro-4-methoxyphenyl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739962 |
| Molecular Formula | C22H24FNO6 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-[(2-fluoro-4-methoxyphenyl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3ccccc23)c(F)c1 |
| InChI | InChI=1S/C22H24FNO6/c1-29-14-7-6-12(16(23)9-14)8-13-10-24(17-5-3-2-4-15(13)17)22-21(28)20(27)19(26)18(11-25)30-22/h2-7,9-10,18-22,25-28H,8,11H2,1H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | NBSCEMICRHPRGD-QMCAAQAGSA-N |
| XLogP | 1.35 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |