C24H32N2O10 — CID 171569456
dimethyl (3S)-2,2-dimethyl-3-[[2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]acetyl]amino]butanedioate (PubChem CID 171569456) has the molecular formula C24H32N2O10 and a molecular weight of 508.52 g/mol. Its IUPAC name is dimethyl (3S)-2,2-dimethyl-3-[[2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]acetyl]amino]butanedioate.
| Compound Name | dimethyl (3S)-2,2-dimethyl-3-[[2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]acetyl]amino]butanedioate |
|---|---|
| PubChem CID | 171569456 |
| Molecular Formula | C24H32N2O10 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | dimethyl (3S)-2,2-dimethyl-3-[[2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]acetyl]amino]butanedioate |
| SMILES | COC(=O)[C@@H](NC(=O)Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2ccccc12)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C24H32N2O10/c1-24(2,23(33)35-4)20(22(32)34-3)25-16(28)9-12-10-26(14-8-6-5-7-13(12)14)21-19(31)18(30)17(29)15(11-27)36-21/h5-8,10,15,17-21,27,29-31H,9,11H2,1-4H3,(H,25,28)/t15-,17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | YUCROFDYWMPUCK-QLOGHZTQSA-N |
| XLogP | -0.99 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |