C9H16N4O6 — CID 154045048
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxyimino-5-methyl-1,3,5-triazinan-2-one (PubChem CID 154045048) has the molecular formula C9H16N4O6 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxyimino-5-methyl-1,3,5-triazinan-2-one.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxyimino-5-methyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 154045048 |
| Molecular Formula | C9H16N4O6 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxyimino-5-methyl-1,3,5-triazinan-2-one |
| SMILES | CN1CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)NC1=NO |
| InChI | InChI=1S/C9H16N4O6/c1-12-3-13(9(17)10-8(12)11-18)7-6(16)5(15)4(2-14)19-7/h4-7,14-16,18H,2-3H2,1H3,(H,10,11,17)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | FFJZTSHFIURSSU-DBRKOABJSA-N |
| XLogP | -2.91 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|