C9H14N2O6 — CID 5273526
1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]piperazine-2,5-dione (PubChem CID 5273526) has the molecular formula C9H14N2O6 and a molecular weight of 246.22 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]piperazine-2,5-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 5273526 |
| Molecular Formula | C9H14N2O6 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]piperazine-2,5-dione |
| SMILES | O=C1CN([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)C(=O)CN1 |
| InChI | InChI=1S/C9H14N2O6/c12-3-4-7(15)8(16)9(17-4)11-2-5(13)10-1-6(11)14/h4,7-9,12,15-16H,1-3H2,(H,10,13)/t4-,7-,8+,9-/m1/s1 |
| InChIKey | IIJFJAQUFQNBSB-LPJZALPJSA-N |
| XLogP | -3.62 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |