C10H15FN2O4 — CID 163548917
3-[(2R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one (PubChem CID 163548917) has the molecular formula C10H15FN2O4 and a molecular weight of 246.24 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one.
| Compound Name | 3-[(2R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 163548917 |
| Molecular Formula | C10H15FN2O4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[(2R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one |
| SMILES | O=C1NCC=CCN1[C@@H]1O[C@H](CO)[C@@H](O)C1F |
| InChI | InChI=1S/C10H15FN2O4/c11-7-8(15)6(5-14)17-9(7)13-4-2-1-3-12-10(13)16/h1-2,6-9,14-15H,3-5H2,(H,12,16)/t6-,7?,8-,9-/m1/s1 |
| InChIKey | FHJRJJBDJACZGH-CWWFFFCGSA-N |
| XLogP | -1.02 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|