C13H16N4O7 — CID 175676815
1-[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carbonyl]pyrrolidine-2,5-dione (PubChem CID 175676815) has the molecular formula C13H16N4O7 and a molecular weight of 340.29 g/mol. Its IUPAC name is 1-[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carbonyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carbonyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175676815 |
| Molecular Formula | C13H16N4O7 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carbonyl]pyrrolidine-2,5-dione |
| SMILES | Nc1c(C(=O)N2C(=O)CCC2=O)ncn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16N4O7/c14-11-8(12(23)17-6(19)1-2-7(17)20)15-4-16(11)13-10(22)9(21)5(3-18)24-13/h4-5,9-10,13,18,21-22H,1-3,14H2/t5-,9-,10-,13-/m1/s1 |
| InChIKey | DRQHRDDMIPQPQJ-MSTPSEHLSA-N |
| XLogP | -2.63 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|